C35H42O5Si — CID 10984659
(2S,3S,4S,5S)-1-[dimethyl(phenyl)silyl]-3,4,6-tris(phenylmethoxy)hexane-2,5-diol (PubChem CID 10984659) has the molecular formula C35H42O5Si and a molecular weight of 570.80 g/mol. Its IUPAC name is (2S,3S,4S,5S)-1-[dimethyl(phenyl)silyl]-3,4,6-tris(phenylmethoxy)hexane-2,5-diol.
| Compound Name | (2S,3S,4S,5S)-1-[dimethyl(phenyl)silyl]-3,4,6-tris(phenylmethoxy)hexane-2,5-diol |
|---|---|
| PubChem CID | 10984659 |
| Molecular Formula | C35H42O5Si |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | (2S,3S,4S,5S)-1-[dimethyl(phenyl)silyl]-3,4,6-tris(phenylmethoxy)hexane-2,5-diol |
| SMILES | C[Si](C)(C[C@@H](O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](O)COCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H42O5Si/c1-41(2,31-21-13-6-14-22-31)27-33(37)35(40-25-30-19-11-5-12-20-30)34(39-24-29-17-9-4-10-18-29)32(36)26-38-23-28-15-7-3-8-16-28/h3-22,32-37H,23-27H2,1-2H3/t32-,33+,34-,35-/m0/s1 |
| InChIKey | ZIUAMUKWPRMBFG-SNSGHMKVSA-N |
| XLogP | 5.71 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|