C34H39NO5 — CID 101237223
(2R,3S,4R,5S)-6-amino-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-ol (PubChem CID 101237223) has the molecular formula C34H39NO5 and a molecular weight of 541.69 g/mol. Its IUPAC name is (2R,3S,4R,5S)-6-amino-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-ol.
| Compound Name | (2R,3S,4R,5S)-6-amino-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-ol |
|---|---|
| PubChem CID | 101237223 |
| Molecular Formula | C34H39NO5 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | (2R,3S,4R,5S)-6-amino-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-ol |
| SMILES | NC[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C34H39NO5/c35-21-32(38-23-28-15-7-2-8-16-28)34(40-25-30-19-11-4-12-20-30)33(39-24-29-17-9-3-10-18-29)31(36)26-37-22-27-13-5-1-6-14-27/h1-20,31-34,36H,21-26,35H2/t31-,32+,33+,34-/m1/s1 |
| InChIKey | ONQRJJRZDKKBHA-ALMGMPQLSA-N |
| XLogP | 5.28 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |