C38H44O6S2 — CID 18637750
(2S,3S,4R,5R)-1-(1,3-dithian-2-yl)-2,3,4,6-tetrakis(phenylmethoxy)hexane-1,5-diol (PubChem CID 18637750) has the molecular formula C38H44O6S2 and a molecular weight of 660.90 g/mol. Its IUPAC name is (2S,3S,4R,5R)-1-(1,3-dithian-2-yl)-2,3,4,6-tetrakis(phenylmethoxy)hexane-1,5-diol.
| Compound Name | (2S,3S,4R,5R)-1-(1,3-dithian-2-yl)-2,3,4,6-tetrakis(phenylmethoxy)hexane-1,5-diol |
|---|---|
| PubChem CID | 18637750 |
| Molecular Formula | C38H44O6S2 |
| Molecular Weight | 660.90 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | (2S,3S,4R,5R)-1-(1,3-dithian-2-yl)-2,3,4,6-tetrakis(phenylmethoxy)hexane-1,5-diol |
| SMILES | OC(C1SCCCS1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C38H44O6S2/c39-33(28-41-24-29-14-5-1-6-15-29)35(42-25-30-16-7-2-8-17-30)37(44-27-32-20-11-4-12-21-32)36(34(40)38-45-22-13-23-46-38)43-26-31-18-9-3-10-19-31/h1-12,14-21,33-40H,13,22-28H2/t33-,34?,35-,36+,37+/m1/s1 |
| InChIKey | KCVRVBBEJVZXII-VAVNFDRSSA-N |
| XLogP | 6.88 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.90 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |