C37H43NO8 — CID 25135765
(2R,3S,4R,5R)-N-(1,3-dihydroxypropan-2-yl)-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexanamide (PubChem CID 25135765) has the molecular formula C37H43NO8 and a molecular weight of 629.75 g/mol. Its IUPAC name is (2R,3S,4R,5R)-N-(1,3-dihydroxypropan-2-yl)-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexanamide.
| Compound Name | (2R,3S,4R,5R)-N-(1,3-dihydroxypropan-2-yl)-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexanamide |
|---|---|
| PubChem CID | 25135765 |
| Molecular Formula | C37H43NO8 |
| Molecular Weight | 629.75 g/mol |
| Exact Mass | 629.30 |
| IUPAC Name | (2R,3S,4R,5R)-N-(1,3-dihydroxypropan-2-yl)-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexanamide |
| SMILES | O=C(NC(CO)CO)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C37H43NO8/c39-21-32(22-40)38-37(42)36(46-26-31-19-11-4-12-20-31)35(45-25-30-17-9-3-10-18-30)34(44-24-29-15-7-2-8-16-29)33(41)27-43-23-28-13-5-1-6-14-28/h1-20,32-36,39-41H,21-27H2,(H,38,42)/t33-,34-,35+,36-/m1/s1 |
| InChIKey | VYCRHNQRJPMHEH-PEDCNLCOSA-N |
| XLogP | 3.79 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |