C37H43NO7 — CID 25135653
(2R,3S,4R,5R)-5-hydroxy-N-[(2R)-2-hydroxypropyl]-2,3,4,6-tetrakis(phenylmethoxy)hexanamide (PubChem CID 25135653) has the molecular formula C37H43NO7 and a molecular weight of 613.75 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-hydroxy-N-[(2R)-2-hydroxypropyl]-2,3,4,6-tetrakis(phenylmethoxy)hexanamide.
| Compound Name | (2R,3S,4R,5R)-5-hydroxy-N-[(2R)-2-hydroxypropyl]-2,3,4,6-tetrakis(phenylmethoxy)hexanamide |
|---|---|
| PubChem CID | 25135653 |
| Molecular Formula | C37H43NO7 |
| Molecular Weight | 613.75 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | (2R,3S,4R,5R)-5-hydroxy-N-[(2R)-2-hydroxypropyl]-2,3,4,6-tetrakis(phenylmethoxy)hexanamide |
| SMILES | C[C@@H](O)CNC(=O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C37H43NO7/c1-28(39)22-38-37(41)36(45-26-32-20-12-5-13-21-32)35(44-25-31-18-10-4-11-19-31)34(43-24-30-16-8-3-9-17-30)33(40)27-42-23-29-14-6-2-7-15-29/h2-21,28,33-36,39-40H,22-27H2,1H3,(H,38,41)/t28-,33-,34-,35+,36-/m1/s1 |
| InChIKey | WYPFAXNEOPQJQT-HKOHKURUSA-N |
| XLogP | 4.82 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.75 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |