C22H26O6 — CID 11417789
methyl (E,4S,5R,6R)-4,6-dihydroxy-5,7-bis(phenylmethoxy)hept-2-enoate (PubChem CID 11417789) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is methyl (E,4S,5R,6R)-4,6-dihydroxy-5,7-bis(phenylmethoxy)hept-2-enoate.
| Compound Name | methyl (E,4S,5R,6R)-4,6-dihydroxy-5,7-bis(phenylmethoxy)hept-2-enoate |
|---|---|
| PubChem CID | 11417789 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | methyl (E,4S,5R,6R)-4,6-dihydroxy-5,7-bis(phenylmethoxy)hept-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](O)[C@@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C22H26O6/c1-26-21(25)13-12-19(23)22(28-15-18-10-6-3-7-11-18)20(24)16-27-14-17-8-4-2-5-9-17/h2-13,19-20,22-24H,14-16H2,1H3/b13-12+/t19-,20+,22+/m0/s1 |
| InChIKey | MUYVTBVCLWIIGM-OWFQPXHCSA-N |
| XLogP | 2.24 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|