C23H29NO6S — CID 10837149
methyl (E,4S,5S)-4-hydroxy-6-phenylmethoxy-5-[(2,4,6-trimethylphenyl)sulfonylamino]hex-2-enoate (PubChem CID 10837149) has the molecular formula C23H29NO6S and a molecular weight of 447.55 g/mol. Its IUPAC name is methyl (E,4S,5S)-4-hydroxy-6-phenylmethoxy-5-[(2,4,6-trimethylphenyl)sulfonylamino]hex-2-enoate.
| Compound Name | methyl (E,4S,5S)-4-hydroxy-6-phenylmethoxy-5-[(2,4,6-trimethylphenyl)sulfonylamino]hex-2-enoate |
|---|---|
| PubChem CID | 10837149 |
| Molecular Formula | C23H29NO6S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | methyl (E,4S,5S)-4-hydroxy-6-phenylmethoxy-5-[(2,4,6-trimethylphenyl)sulfonylamino]hex-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](O)[C@H](COCc1ccccc1)NS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C23H29NO6S/c1-16-12-17(2)23(18(3)13-16)31(27,28)24-20(21(25)10-11-22(26)29-4)15-30-14-19-8-6-5-7-9-19/h5-13,20-21,24-25H,14-15H2,1-4H3/b11-10+/t20-,21-/m0/s1 |
| InChIKey | ALQRQVILSAVQMF-YGEFIYNQSA-N |
| XLogP | 2.57 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|