C16H22O5 — CID 72723656
methyl (E,4S,5S,6S)-4,5-dihydroxy-6-methyl-7-phenylmethoxyhept-2-enoate (PubChem CID 72723656) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl (E,4S,5S,6S)-4,5-dihydroxy-6-methyl-7-phenylmethoxyhept-2-enoate.
| Compound Name | methyl (E,4S,5S,6S)-4,5-dihydroxy-6-methyl-7-phenylmethoxyhept-2-enoate |
|---|---|
| PubChem CID | 72723656 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | methyl (E,4S,5S,6S)-4,5-dihydroxy-6-methyl-7-phenylmethoxyhept-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](O)[C@@H](O)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C16H22O5/c1-12(10-21-11-13-6-4-3-5-7-13)16(19)14(17)8-9-15(18)20-2/h3-9,12,14,16-17,19H,10-11H2,1-2H3/b9-8+/t12-,14-,16-/m0/s1 |
| InChIKey | KOTVVKQYYYKFBS-AKHNQNMBSA-N |
| XLogP | 1.29 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|