C23H36O3 — CID 135008412
(3Z,6E,10R)-2,4,6,8,10-pentamethyl-11-phenylmethoxyundeca-3,6-diene-1,9-diol (PubChem CID 135008412) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (3Z,6E,10R)-2,4,6,8,10-pentamethyl-11-phenylmethoxyundeca-3,6-diene-1,9-diol.
| Compound Name | (3Z,6E,10R)-2,4,6,8,10-pentamethyl-11-phenylmethoxyundeca-3,6-diene-1,9-diol |
|---|---|
| PubChem CID | 135008412 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (3Z,6E,10R)-2,4,6,8,10-pentamethyl-11-phenylmethoxyundeca-3,6-diene-1,9-diol |
| SMILES | C/C(=C/C(C)CO)C/C(C)=C/C(C)C(O)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C23H36O3/c1-17(12-19(3)14-24)11-18(2)13-20(4)23(25)21(5)15-26-16-22-9-7-6-8-10-22/h6-10,12-13,19-21,23-25H,11,14-16H2,1-5H3/b17-12-,18-13+/t19?,20?,21-,23?/m1/s1 |
| InChIKey | QHADFNDITFRKCI-KCZCSWOBSA-N |
| XLogP | 4.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|