C15H22O2 — CID 164675342
(E,2S,3R)-2,4-dimethyl-1-phenylmethoxyhex-4-en-3-ol (PubChem CID 164675342) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (E,2S,3R)-2,4-dimethyl-1-phenylmethoxyhex-4-en-3-ol.
| Compound Name | (E,2S,3R)-2,4-dimethyl-1-phenylmethoxyhex-4-en-3-ol |
|---|---|
| PubChem CID | 164675342 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (E,2S,3R)-2,4-dimethyl-1-phenylmethoxyhex-4-en-3-ol |
| SMILES | C/C=C(\C)[C@H](O)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C15H22O2/c1-4-12(2)15(16)13(3)10-17-11-14-8-6-5-7-9-14/h4-9,13,15-16H,10-11H2,1-3H3/b12-4+/t13-,15-/m0/s1 |
| InChIKey | XKRNMOCRDXYUNU-WNCBDUDASA-N |
| XLogP | 3.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|