C15H22O3 — CID 71540760
(E,2R,3R)-2,4-dimethyl-6-phenylmethoxyhex-4-ene-1,3-diol (PubChem CID 71540760) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (E,2R,3R)-2,4-dimethyl-6-phenylmethoxyhex-4-ene-1,3-diol.
| Compound Name | (E,2R,3R)-2,4-dimethyl-6-phenylmethoxyhex-4-ene-1,3-diol |
|---|---|
| PubChem CID | 71540760 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (E,2R,3R)-2,4-dimethyl-6-phenylmethoxyhex-4-ene-1,3-diol |
| SMILES | C/C(=C\COCc1ccccc1)[C@H](O)[C@H](C)CO |
| InChI | InChI=1S/C15H22O3/c1-12(15(17)13(2)10-16)8-9-18-11-14-6-4-3-5-7-14/h3-8,13,15-17H,9-11H2,1-2H3/b12-8+/t13-,15+/m1/s1 |
| InChIKey | XZFMWWMIDHRYAS-CSPHYMHISA-N |
| XLogP | 2.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|