C22H29NO3 — CID 69233656
(2R,3S)-3-(4-methoxyanilino)-2,4-dimethyl-6-phenylmethoxyhex-4-en-1-ol (PubChem CID 69233656) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (2R,3S)-3-(4-methoxyanilino)-2,4-dimethyl-6-phenylmethoxyhex-4-en-1-ol.
| Compound Name | (2R,3S)-3-(4-methoxyanilino)-2,4-dimethyl-6-phenylmethoxyhex-4-en-1-ol |
|---|---|
| PubChem CID | 69233656 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (2R,3S)-3-(4-methoxyanilino)-2,4-dimethyl-6-phenylmethoxyhex-4-en-1-ol |
| SMILES | COc1ccc(N[C@H](C(C)=CCOCc2ccccc2)[C@@H](C)CO)cc1 |
| InChI | InChI=1S/C22H29NO3/c1-17(13-14-26-16-19-7-5-4-6-8-19)22(18(2)15-24)23-20-9-11-21(25-3)12-10-20/h4-13,18,22-24H,14-16H2,1-3H3/t18-,22+/m0/s1 |
| InChIKey | GVRQWGTUMGJIEH-PGRDOPGGSA-N |
| XLogP | 4.27 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|