C20H23NO5 — CID 11451165
ethyl (2S,3S)-2-(4-methoxyanilino)-4-oxo-3-phenylmethoxybutanoate (PubChem CID 11451165) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is ethyl (2S,3S)-2-(4-methoxyanilino)-4-oxo-3-phenylmethoxybutanoate.
| Compound Name | ethyl (2S,3S)-2-(4-methoxyanilino)-4-oxo-3-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 11451165 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | ethyl (2S,3S)-2-(4-methoxyanilino)-4-oxo-3-phenylmethoxybutanoate |
| SMILES | CCOC(=O)[C@@H](Nc1ccc(OC)cc1)[C@@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H23NO5/c1-3-25-20(23)19(21-16-9-11-17(24-2)12-10-16)18(13-22)26-14-15-7-5-4-6-8-15/h4-13,18-19,21H,3,14H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | LKILROGNERCYLX-MOPGFXCFSA-N |
| XLogP | 2.82 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|