C17H23NO4 — CID 134918506
ethyl (2S,3R)-3-formyl-2-(4-methoxyanilino)hept-6-enoate (PubChem CID 134918506) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is ethyl (2S,3R)-3-formyl-2-(4-methoxyanilino)hept-6-enoate.
| Compound Name | ethyl (2S,3R)-3-formyl-2-(4-methoxyanilino)hept-6-enoate |
|---|---|
| PubChem CID | 134918506 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | ethyl (2S,3R)-3-formyl-2-(4-methoxyanilino)hept-6-enoate |
| SMILES | C=CCC[C@@H](C=O)[C@H](Nc1ccc(OC)cc1)C(=O)OCC |
| InChI | InChI=1S/C17H23NO4/c1-4-6-7-13(12-19)16(17(20)22-5-2)18-14-8-10-15(21-3)11-9-14/h4,8-13,16,18H,1,5-7H2,2-3H3/t13-,16-/m0/s1 |
| InChIKey | UEJILKTXYXKJQM-BBRMVZONSA-N |
| XLogP | 2.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|