C21H31NO4 — CID 154720263
ethyl (2S,3R,4S)-3-formyl-2-(4-methoxyanilino)-4,8-dimethylnon-7-enoate (PubChem CID 154720263) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is ethyl (2S,3R,4S)-3-formyl-2-(4-methoxyanilino)-4,8-dimethylnon-7-enoate.
| Compound Name | ethyl (2S,3R,4S)-3-formyl-2-(4-methoxyanilino)-4,8-dimethylnon-7-enoate |
|---|---|
| PubChem CID | 154720263 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | ethyl (2S,3R,4S)-3-formyl-2-(4-methoxyanilino)-4,8-dimethylnon-7-enoate |
| SMILES | CCOC(=O)[C@@H](Nc1ccc(OC)cc1)[C@H](C=O)[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C21H31NO4/c1-6-26-21(24)20(22-17-10-12-18(25-5)13-11-17)19(14-23)16(4)9-7-8-15(2)3/h8,10-14,16,19-20,22H,6-7,9H2,1-5H3/t16-,19+,20-/m0/s1 |
| InChIKey | FSHSEZZYGRMIEB-DBVUQKKJSA-N |
| XLogP | 4.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|