C18H27NO4 — CID 101379387
tert-butyl (2S,3R)-3-formyl-2-(4-methoxyanilino)-4-methylpentanoate (PubChem CID 101379387) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-formyl-2-(4-methoxyanilino)-4-methylpentanoate.
| Compound Name | tert-butyl (2S,3R)-3-formyl-2-(4-methoxyanilino)-4-methylpentanoate |
|---|---|
| PubChem CID | 101379387 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | tert-butyl (2S,3R)-3-formyl-2-(4-methoxyanilino)-4-methylpentanoate |
| SMILES | COc1ccc(N[C@H](C(=O)OC(C)(C)C)[C@H](C=O)C(C)C)cc1 |
| InChI | InChI=1S/C18H27NO4/c1-12(2)15(11-20)16(17(21)23-18(3,4)5)19-13-7-9-14(22-6)10-8-13/h7-12,15-16,19H,1-6H3/t15-,16+/m1/s1 |
| InChIKey | MLLZSZBJKRYAPS-CVEARBPZSA-N |
| XLogP | 3.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|