C12H18N2O3 — CID 10105611
methyl (2R,3S)-3-amino-2-(4-methoxyanilino)butanoate (PubChem CID 10105611) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is methyl (2R,3S)-3-amino-2-(4-methoxyanilino)butanoate.
| Compound Name | methyl (2R,3S)-3-amino-2-(4-methoxyanilino)butanoate |
|---|---|
| PubChem CID | 10105611 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | methyl (2R,3S)-3-amino-2-(4-methoxyanilino)butanoate |
| SMILES | COC(=O)[C@H](Nc1ccc(OC)cc1)[C@H](C)N |
| InChI | InChI=1S/C12H18N2O3/c1-8(13)11(12(15)17-3)14-9-4-6-10(16-2)7-5-9/h4-8,11,14H,13H2,1-3H3/t8-,11+/m0/s1 |
| InChIKey | XTVSRBHYKYNUFC-GZMMTYOYSA-N |
| XLogP | 1.00 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|