C14H16F5NO3 — CID 101061953
methyl (2R,3S)-4,4,5,5,5-pentafluoro-3-(4-methoxyanilino)-2-methylpentanoate (PubChem CID 101061953) has the molecular formula C14H16F5NO3 and a molecular weight of 341.28 g/mol. Its IUPAC name is methyl (2R,3S)-4,4,5,5,5-pentafluoro-3-(4-methoxyanilino)-2-methylpentanoate.
| Compound Name | methyl (2R,3S)-4,4,5,5,5-pentafluoro-3-(4-methoxyanilino)-2-methylpentanoate |
|---|---|
| PubChem CID | 101061953 |
| Molecular Formula | C14H16F5NO3 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | methyl (2R,3S)-4,4,5,5,5-pentafluoro-3-(4-methoxyanilino)-2-methylpentanoate |
| SMILES | COC(=O)[C@H](C)[C@H](Nc1ccc(OC)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H16F5NO3/c1-8(12(21)23-3)11(13(15,16)14(17,18)19)20-9-4-6-10(22-2)7-5-9/h4-8,11,20H,1-3H3/t8-,11+/m1/s1 |
| InChIKey | YRJXPIDRNHFSIF-KCJUWKMLSA-N |
| XLogP | 3.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|