C17H23F3N2O4 — CID 101397777
methyl (2S)-4-methyl-2-[[3,3,3-trifluoro-2-(4-methoxyanilino)propanoyl]amino]pentanoate (PubChem CID 101397777) has the molecular formula C17H23F3N2O4 and a molecular weight of 376.38 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-[[3,3,3-trifluoro-2-(4-methoxyanilino)propanoyl]amino]pentanoate.
| Compound Name | methyl (2S)-4-methyl-2-[[3,3,3-trifluoro-2-(4-methoxyanilino)propanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 101397777 |
| Molecular Formula | C17H23F3N2O4 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | methyl (2S)-4-methyl-2-[[3,3,3-trifluoro-2-(4-methoxyanilino)propanoyl]amino]pentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)C(Nc1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H23F3N2O4/c1-10(2)9-13(16(24)26-4)22-15(23)14(17(18,19)20)21-11-5-7-12(25-3)8-6-11/h5-8,10,13-14,21H,9H2,1-4H3,(H,22,23)/t13-,14?/m0/s1 |
| InChIKey | CGOOUFGUFWYVIX-LSLKUGRBSA-N |
| XLogP | 2.74 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|