C16H24N2O5 — CID 51426599
methyl (2R)-2-[(2,5-dimethoxyphenyl)carbamoylamino]-4-methylpentanoate (PubChem CID 51426599) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is methyl (2R)-2-[(2,5-dimethoxyphenyl)carbamoylamino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[(2,5-dimethoxyphenyl)carbamoylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 51426599 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | methyl (2R)-2-[(2,5-dimethoxyphenyl)carbamoylamino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H24N2O5/c1-10(2)8-13(15(19)23-5)18-16(20)17-12-9-11(21-3)6-7-14(12)22-4/h6-7,9-10,13H,8H2,1-5H3,(H2,17,18,20)/t13-/m1/s1 |
| InChIKey | LHGPSLVERWLHGV-CYBMUJFWSA-N |
| XLogP | 2.41 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |