C16H19N3O3 — CID 40635753
1-(2,5-dimethoxyphenyl)-3-[(1S)-1-pyridin-4-ylethyl]urea (PubChem CID 40635753) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-[(1S)-1-pyridin-4-ylethyl]urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-[(1S)-1-pyridin-4-ylethyl]urea |
|---|---|
| PubChem CID | 40635753 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-[(1S)-1-pyridin-4-ylethyl]urea |
| SMILES | COc1ccc(OC)c(NC(=O)N[C@@H](C)c2ccncc2)c1 |
| InChI | InChI=1S/C16H19N3O3/c1-11(12-6-8-17-9-7-12)18-16(20)19-14-10-13(21-2)4-5-15(14)22-3/h4-11H,1-3H3,(H2,18,19,20)/t11-/m0/s1 |
| InChIKey | UPYMFMZJUWMANF-NSHDSACASA-N |
| XLogP | 2.98 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |