C16H19N3O — CID 40637085
1-(2,4-dimethylphenyl)-3-[(1R)-1-pyridin-4-ylethyl]urea (PubChem CID 40637085) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[(1R)-1-pyridin-4-ylethyl]urea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[(1R)-1-pyridin-4-ylethyl]urea |
|---|---|
| PubChem CID | 40637085 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[(1R)-1-pyridin-4-ylethyl]urea |
| SMILES | Cc1ccc(NC(=O)N[C@H](C)c2ccncc2)c(C)c1 |
| InChI | InChI=1S/C16H19N3O/c1-11-4-5-15(12(2)10-11)19-16(20)18-13(3)14-6-8-17-9-7-14/h4-10,13H,1-3H3,(H2,18,19,20)/t13-/m1/s1 |
| InChIKey | WYDJZBQXDODOFO-CYBMUJFWSA-N |
| XLogP | 3.58 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |