C15H21ClN2O4 — CID 944223
methyl (2S)-2-[(3-chloro-4-methoxyphenyl)carbamoylamino]-4-methylpentanoate (PubChem CID 944223) has the molecular formula C15H21ClN2O4 and a molecular weight of 328.80 g/mol. Its IUPAC name is methyl (2S)-2-[(3-chloro-4-methoxyphenyl)carbamoylamino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[(3-chloro-4-methoxyphenyl)carbamoylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 944223 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | methyl (2S)-2-[(3-chloro-4-methoxyphenyl)carbamoylamino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2O4/c1-9(2)7-12(14(19)22-4)18-15(20)17-10-5-6-13(21-3)11(16)8-10/h5-6,8-9,12H,7H2,1-4H3,(H2,17,18,20)/t12-/m0/s1 |
| InChIKey | LCUAWMHPRGWZEY-LBPRGKRZSA-N |
| XLogP | 3.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |