C15H21Cl2N3O2 — CID 51957415
(2R)-2-[(3,4-dichlorophenyl)carbamoylamino]-N,N,4-trimethylpentanamide (PubChem CID 51957415) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is (2R)-2-[(3,4-dichlorophenyl)carbamoylamino]-N,N,4-trimethylpentanamide.
| Compound Name | (2R)-2-[(3,4-dichlorophenyl)carbamoylamino]-N,N,4-trimethylpentanamide |
|---|---|
| PubChem CID | 51957415 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (2R)-2-[(3,4-dichlorophenyl)carbamoylamino]-N,N,4-trimethylpentanamide |
| SMILES | CC(C)C[C@@H](NC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)N(C)C |
| InChI | InChI=1S/C15H21Cl2N3O2/c1-9(2)7-13(14(21)20(3)4)19-15(22)18-10-5-6-11(16)12(17)8-10/h5-6,8-9,13H,7H2,1-4H3,(H2,18,19,22)/t13-/m1/s1 |
| InChIKey | DLSAXCJBTZHBSM-CYBMUJFWSA-N |
| XLogP | 3.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |