C17H19Cl2N3O — CID 24528764
1-(3,4-dichlorophenyl)-3-[2-(dimethylamino)-1-phenylethyl]urea (PubChem CID 24528764) has the molecular formula C17H19Cl2N3O and a molecular weight of 352.27 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[2-(dimethylamino)-1-phenylethyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[2-(dimethylamino)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 24528764 |
| Molecular Formula | C17H19Cl2N3O |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[2-(dimethylamino)-1-phenylethyl]urea |
| SMILES | CN(C)CC(NC(=O)Nc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C17H19Cl2N3O/c1-22(2)11-16(12-6-4-3-5-7-12)21-17(23)20-13-8-9-14(18)15(19)10-13/h3-10,16H,11H2,1-2H3,(H2,20,21,23) |
| InChIKey | PVSYMFXIUKBAGQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |