C15H24N2O2 — CID 114200888
2-(4-methoxyanilino)-3,5-dimethylhexanamide (PubChem CID 114200888) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-3,5-dimethylhexanamide.
| Compound Name | 2-(4-methoxyanilino)-3,5-dimethylhexanamide |
|---|---|
| PubChem CID | 114200888 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-(4-methoxyanilino)-3,5-dimethylhexanamide |
| SMILES | COc1ccc(NC(C(N)=O)C(C)CC(C)C)cc1 |
| InChI | InChI=1S/C15H24N2O2/c1-10(2)9-11(3)14(15(16)18)17-12-5-7-13(19-4)8-6-12/h5-8,10-11,14,17H,9H2,1-4H3,(H2,16,18) |
| InChIKey | NIPGEIOIUNNHLX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|