C14H21NO3 — CID 11448103
(2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid (PubChem CID 11448103) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid.
| Compound Name | (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 11448103 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid |
| SMILES | COc1ccc(N[C@H](C(C)C)[C@@H](C)C(=O)O)cc1 |
| InChI | InChI=1S/C14H21NO3/c1-9(2)13(10(3)14(16)17)15-11-5-7-12(18-4)8-6-11/h5-10,13,15H,1-4H3,(H,16,17)/t10-,13-/m1/s1 |
| InChIKey | XMPCKPNUWDVDLM-ZWNOBZJWSA-N |
| XLogP | 2.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|