(2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid

C14H21NO3 — CID 11448103

IUPAC(2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid
SMILESCOc1ccc(N[C@H](C(C)C)[C@@H](C)C(=O)O)cc1
InChIInChI=1S/C14H21NO3/c1-9(2)13(10(3)14(16)17)15-11-5-7-12(18-4)8-6-11/h5-10,13,15H,1-4H3,(H,16,17)/t10-,13-/m1/s1
InChIKeyXMPCKPNUWDVDLM-ZWNOBZJWSA-N
MW251.33 g/mol
LogP2.85
Rot. Bonds6

About (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid

(2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid (PubChem CID 11448103) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid.

Molecular Properties

Compound Name(2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid
PubChem CID11448103
Molecular FormulaC14H21NO3
Molecular Weight251.33 g/mol
Exact Mass251.15
IUPAC Name(2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid
SMILESCOc1ccc(N[C@H](C(C)C)[C@@H](C)C(=O)O)cc1
InChIInChI=1S/C14H21NO3/c1-9(2)13(10(3)14(16)17)15-11-5-7-12(18-4)8-6-11/h5-10,13,15H,1-4H3,(H,16,17)/t10-,13-/m1/s1
InChIKeyXMPCKPNUWDVDLM-ZWNOBZJWSA-N
XLogP2.85
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.33
LogP ≤ 52.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}

Analyze (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid?
The IUPAC name of (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid (CID 11448103) is (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid.
What is the SMILES notation for (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid?
The canonical SMILES for (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid is COc1ccc(N[C@H](C(C)C)[C@@H](C)C(=O)O)cc1.
What is the InChIKey of (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid?
The InChIKey is XMPCKPNUWDVDLM-ZWNOBZJWSA-N. The full InChI is InChI=1S/C14H21NO3/c1-9(2)13(10(3)14(16)17)15-11-5-7-12(18-4)8-6-11/h5-10,13,15H,1-4H3,(H,16,17)/t10-,13-/m1/s1.
What are the key properties of (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid?
(2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid has a molecular weight of 251.33 g/mol, XLogP of 2.85, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-(4-methoxyanilino)-2,4-dimethylpentanoic acid is sourced from PubChem (CID 11448103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).