C14H21NO4 — CID 101459600
(3R,4R)-1,3-dihydroxy-4-(4-methoxyanilino)-5-methylhexan-2-one (PubChem CID 101459600) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is (3R,4R)-1,3-dihydroxy-4-(4-methoxyanilino)-5-methylhexan-2-one.
| Compound Name | (3R,4R)-1,3-dihydroxy-4-(4-methoxyanilino)-5-methylhexan-2-one |
|---|---|
| PubChem CID | 101459600 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | (3R,4R)-1,3-dihydroxy-4-(4-methoxyanilino)-5-methylhexan-2-one |
| SMILES | COc1ccc(N[C@H](C(C)C)[C@@H](O)C(=O)CO)cc1 |
| InChI | InChI=1S/C14H21NO4/c1-9(2)13(14(18)12(17)8-16)15-10-4-6-11(19-3)7-5-10/h4-7,9,13-16,18H,8H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | OBGOOBJGHUNZJK-KGLIPLIRSA-N |
| XLogP | 1.05 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|