C11H15NO3 — CID 139626636
(2R)-2-hydroxy-N-(4-methoxyphenyl)butanamide (PubChem CID 139626636) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is (2R)-2-hydroxy-N-(4-methoxyphenyl)butanamide.
| Compound Name | (2R)-2-hydroxy-N-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 139626636 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (2R)-2-hydroxy-N-(4-methoxyphenyl)butanamide |
| SMILES | CC[C@@H](O)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C11H15NO3/c1-3-10(13)11(14)12-8-4-6-9(15-2)7-5-8/h4-7,10,13H,3H2,1-2H3,(H,12,14)/t10-/m1/s1 |
| InChIKey | BMMSRONMQQTANS-SNVBAGLBSA-N |
| XLogP | 1.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |