C14H21NO7 — CID 129145601
(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)-N-(4-methoxyphenyl)hexanamide (PubChem CID 129145601) has the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)-N-(4-methoxyphenyl)hexanamide.
| Compound Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)-N-(4-methoxyphenyl)hexanamide |
|---|---|
| PubChem CID | 129145601 |
| Molecular Formula | C14H21NO7 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)-N-(4-methoxyphenyl)hexanamide |
| SMILES | COc1ccc(NC(=O)C(CO)[C@@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C14H21NO7/c1-22-9-4-2-8(3-5-9)15-14(21)10(6-16)12(19)13(20)11(18)7-17/h2-5,10-13,16-20H,6-7H2,1H3,(H,15,21)/t10?,11-,12-,13-/m1/s1 |
| InChIKey | HZVXZTDWFCSFQS-KIGPFUIMSA-N |
| XLogP | -1.68 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |