C11H16N2O5 — CID 54431167
(2R,3R,4R)-N-(4-aminophenyl)-2,3,4,5-tetrahydroxypentanamide (PubChem CID 54431167) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is (2R,3R,4R)-N-(4-aminophenyl)-2,3,4,5-tetrahydroxypentanamide.
| Compound Name | (2R,3R,4R)-N-(4-aminophenyl)-2,3,4,5-tetrahydroxypentanamide |
|---|---|
| PubChem CID | 54431167 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (2R,3R,4R)-N-(4-aminophenyl)-2,3,4,5-tetrahydroxypentanamide |
| SMILES | Nc1ccc(NC(=O)[C@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C11H16N2O5/c12-6-1-3-7(4-2-6)13-11(18)10(17)9(16)8(15)5-14/h1-4,8-10,14-17H,5,12H2,(H,13,18)/t8-,9-,10-/m1/s1 |
| InChIKey | WHOXODNEBMKFGY-OPRDCNLKSA-N |
| XLogP | -1.72 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|