C12H18N2O3S — CID 79682480
N-(4-aminophenyl)-2-(2,3-dihydroxypropylsulfanyl)propanamide (PubChem CID 79682480) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-(2,3-dihydroxypropylsulfanyl)propanamide.
| Compound Name | N-(4-aminophenyl)-2-(2,3-dihydroxypropylsulfanyl)propanamide |
|---|---|
| PubChem CID | 79682480 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-(4-aminophenyl)-2-(2,3-dihydroxypropylsulfanyl)propanamide |
| SMILES | CC(SCC(O)CO)C(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C12H18N2O3S/c1-8(18-7-11(16)6-15)12(17)14-10-4-2-9(13)3-5-10/h2-5,8,11,15-16H,6-7,13H2,1H3,(H,14,17) |
| InChIKey | WGHURDCTDPHKGA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|