C13H21N3O3 — CID 61242810
N-(4-aminophenyl)-2-[bis(2-hydroxyethyl)amino]propanamide (PubChem CID 61242810) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-[bis(2-hydroxyethyl)amino]propanamide.
| Compound Name | N-(4-aminophenyl)-2-[bis(2-hydroxyethyl)amino]propanamide |
|---|---|
| PubChem CID | 61242810 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-(4-aminophenyl)-2-[bis(2-hydroxyethyl)amino]propanamide |
| SMILES | CC(C(=O)Nc1ccc(N)cc1)N(CCO)CCO |
| InChI | InChI=1S/C13H21N3O3/c1-10(16(6-8-17)7-9-18)13(19)15-12-4-2-11(14)3-5-12/h2-5,10,17-18H,6-9,14H2,1H3,(H,15,19) |
| InChIKey | UEQCPBJSGHDCFZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|