C13H19N5O3 — CID 62921681
N-(4-aminophenyl)-2-[bis(2-amino-2-oxoethyl)amino]propanamide (PubChem CID 62921681) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-[bis(2-amino-2-oxoethyl)amino]propanamide.
| Compound Name | N-(4-aminophenyl)-2-[bis(2-amino-2-oxoethyl)amino]propanamide |
|---|---|
| PubChem CID | 62921681 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-(4-aminophenyl)-2-[bis(2-amino-2-oxoethyl)amino]propanamide |
| SMILES | CC(C(=O)Nc1ccc(N)cc1)N(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C13H19N5O3/c1-8(18(6-11(15)19)7-12(16)20)13(21)17-10-4-2-9(14)3-5-10/h2-5,8H,6-7,14H2,1H3,(H2,15,19)(H2,16,20)(H,17,21) |
| InChIKey | QEEBRKKCQBOGST-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 144.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|