C12H17N5O3 — CID 62924176
2-[[2-(4-aminoanilino)-2-oxoethyl]-(2-amino-2-oxoethyl)amino]acetamide (PubChem CID 62924176) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-[[2-(4-aminoanilino)-2-oxoethyl]-(2-amino-2-oxoethyl)amino]acetamide.
| Compound Name | 2-[[2-(4-aminoanilino)-2-oxoethyl]-(2-amino-2-oxoethyl)amino]acetamide |
|---|---|
| PubChem CID | 62924176 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-[[2-(4-aminoanilino)-2-oxoethyl]-(2-amino-2-oxoethyl)amino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)CC(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C12H17N5O3/c13-8-1-3-9(4-2-8)16-12(20)7-17(5-10(14)18)6-11(15)19/h1-4H,5-7,13H2,(H2,14,18)(H2,15,19)(H,16,20) |
| InChIKey | GKDCGXIAKORHFZ-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 144.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|