C12H16ClN5O3 — CID 62921849
2-[[2-(4-amino-2-chloroanilino)-2-oxoethyl]-(2-amino-2-oxoethyl)amino]acetamide (PubChem CID 62921849) has the molecular formula C12H16ClN5O3 and a molecular weight of 313.75 g/mol. Its IUPAC name is 2-[[2-(4-amino-2-chloroanilino)-2-oxoethyl]-(2-amino-2-oxoethyl)amino]acetamide.
| Compound Name | 2-[[2-(4-amino-2-chloroanilino)-2-oxoethyl]-(2-amino-2-oxoethyl)amino]acetamide |
|---|---|
| PubChem CID | 62921849 |
| Molecular Formula | C12H16ClN5O3 |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-[[2-(4-amino-2-chloroanilino)-2-oxoethyl]-(2-amino-2-oxoethyl)amino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)CC(=O)Nc1ccc(N)cc1Cl |
| InChI | InChI=1S/C12H16ClN5O3/c13-8-3-7(14)1-2-9(8)17-12(21)6-18(4-10(15)19)5-11(16)20/h1-3H,4-6,14H2,(H2,15,19)(H2,16,20)(H,17,21) |
| InChIKey | SGXQJRQBILJYJI-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 144.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|