C14H21ClN4O2 — CID 103101430
N-(4-amino-2-chlorophenyl)-4-[(2-amino-2-oxoethyl)-ethylamino]butanamide (PubChem CID 103101430) has the molecular formula C14H21ClN4O2 and a molecular weight of 312.80 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-4-[(2-amino-2-oxoethyl)-ethylamino]butanamide.
| Compound Name | N-(4-amino-2-chlorophenyl)-4-[(2-amino-2-oxoethyl)-ethylamino]butanamide |
|---|---|
| PubChem CID | 103101430 |
| Molecular Formula | C14H21ClN4O2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-4-[(2-amino-2-oxoethyl)-ethylamino]butanamide |
| SMILES | CCN(CCCC(=O)Nc1ccc(N)cc1Cl)CC(N)=O |
| InChI | InChI=1S/C14H21ClN4O2/c1-2-19(9-13(17)20)7-3-4-14(21)18-12-6-5-10(16)8-11(12)15/h5-6,8H,2-4,7,9,16H2,1H3,(H2,17,20)(H,18,21) |
| InChIKey | ALFXSYXOWDNFLT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|