C36H42I2N6O2 — CID 155453992
2-[(4-aminophenyl)methyl-[6-[(4-aminophenyl)methyl-[2-(4-iodoanilino)-2-oxoethyl]amino]hexyl]amino]-N-(4-iodophenyl)acetamide (PubChem CID 155453992) has the molecular formula C36H42I2N6O2 and a molecular weight of 844.58 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methyl-[6-[(4-aminophenyl)methyl-[2-(4-iodoanilino)-2-oxoethyl]amino]hexyl]amino]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(4-aminophenyl)methyl-[6-[(4-aminophenyl)methyl-[2-(4-iodoanilino)-2-oxoethyl]amino]hexyl]amino]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 155453992 |
| Molecular Formula | C36H42I2N6O2 |
| Molecular Weight | 844.58 g/mol |
| Exact Mass | 844.15 |
| IUPAC Name | 2-[(4-aminophenyl)methyl-[6-[(4-aminophenyl)methyl-[2-(4-iodoanilino)-2-oxoethyl]amino]hexyl]amino]-N-(4-iodophenyl)acetamide |
| SMILES | Nc1ccc(CN(CCCCCCN(CC(=O)Nc2ccc(I)cc2)Cc2ccc(N)cc2)CC(=O)Nc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C36H42I2N6O2/c37-29-9-17-33(18-10-29)41-35(45)25-43(23-27-5-13-31(39)14-6-27)21-3-1-2-4-22-44(24-28-7-15-32(40)16-8-28)26-36(46)42-34-19-11-30(38)12-20-34/h5-20H,1-4,21-26,39-40H2,(H,41,45)(H,42,46) |
| InChIKey | JXZMQUQTZKDEFU-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.58 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|