C36H38I2N6O6 — CID 165375318
2-[6-[[2-(4-iodoanilino)-2-oxoethyl]-[(4-nitrophenyl)methyl]amino]hexyl-[(4-nitrophenyl)methyl]amino]-N-(4-iodophenyl)acetamide (PubChem CID 165375318) has the molecular formula C36H38I2N6O6 and a molecular weight of 904.54 g/mol. Its IUPAC name is 2-[6-[[2-(4-iodoanilino)-2-oxoethyl]-[(4-nitrophenyl)methyl]amino]hexyl-[(4-nitrophenyl)methyl]amino]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[6-[[2-(4-iodoanilino)-2-oxoethyl]-[(4-nitrophenyl)methyl]amino]hexyl-[(4-nitrophenyl)methyl]amino]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 165375318 |
| Molecular Formula | C36H38I2N6O6 |
| Molecular Weight | 904.54 g/mol |
| Exact Mass | 904.09 |
| IUPAC Name | 2-[6-[[2-(4-iodoanilino)-2-oxoethyl]-[(4-nitrophenyl)methyl]amino]hexyl-[(4-nitrophenyl)methyl]amino]-N-(4-iodophenyl)acetamide |
| SMILES | O=C(CN(CCCCCCN(CC(=O)Nc1ccc(I)cc1)Cc1ccc([N+](=O)[O-])cc1)Cc1ccc([N+](=O)[O-])cc1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C36H38I2N6O6/c37-29-9-13-31(14-10-29)39-35(45)25-41(23-27-5-17-33(18-6-27)43(47)48)21-3-1-2-4-22-42(24-28-7-19-34(20-8-28)44(49)50)26-36(46)40-32-15-11-30(38)12-16-32/h5-20H,1-4,21-26H2,(H,39,45)(H,40,46) |
| InChIKey | PCXGNZUULKDOCE-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 150.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.54 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|