C15H14IN3O5S — CID 17192861
N-(4-iodophenyl)-3-[(4-nitrophenyl)sulfonylamino]propanamide (PubChem CID 17192861) has the molecular formula C15H14IN3O5S and a molecular weight of 475.26 g/mol. Its IUPAC name is N-(4-iodophenyl)-3-[(4-nitrophenyl)sulfonylamino]propanamide.
| Compound Name | N-(4-iodophenyl)-3-[(4-nitrophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 17192861 |
| Molecular Formula | C15H14IN3O5S |
| Molecular Weight | 475.26 g/mol |
| Exact Mass | 474.97 |
| IUPAC Name | N-(4-iodophenyl)-3-[(4-nitrophenyl)sulfonylamino]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C15H14IN3O5S/c16-11-1-3-12(4-2-11)18-15(20)9-10-17-25(23,24)14-7-5-13(6-8-14)19(21)22/h1-8,17H,9-10H2,(H,18,20) |
| InChIKey | KFZNGKOBLMPRLN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|