C19H18N6O7S2 — CID 17192958
3-[(4-nitrophenyl)sulfonylamino]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide (PubChem CID 17192958) has the molecular formula C19H18N6O7S2 and a molecular weight of 506.52 g/mol. Its IUPAC name is 3-[(4-nitrophenyl)sulfonylamino]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-[(4-nitrophenyl)sulfonylamino]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 17192958 |
| Molecular Formula | C19H18N6O7S2 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | 3-[(4-nitrophenyl)sulfonylamino]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C19H18N6O7S2/c26-18(10-13-22-33(29,30)16-8-4-15(5-9-16)25(27)28)23-14-2-6-17(7-3-14)34(31,32)24-19-20-11-1-12-21-19/h1-9,11-12,22H,10,13H2,(H,23,26)(H,20,21,24) |
| InChIKey | JRSADMBDHSWXJN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 190.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|