C17H17N7O5S — CID 19568038
3-(5-methyl-4-nitropyrazol-1-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide (PubChem CID 19568038) has the molecular formula C17H17N7O5S and a molecular weight of 431.43 g/mol. Its IUPAC name is 3-(5-methyl-4-nitropyrazol-1-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-(5-methyl-4-nitropyrazol-1-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 19568038 |
| Molecular Formula | C17H17N7O5S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 3-(5-methyl-4-nitropyrazol-1-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
| SMILES | Cc1c([N+](=O)[O-])cnn1CCC(=O)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C17H17N7O5S/c1-12-15(24(26)27)11-20-23(12)10-7-16(25)21-13-3-5-14(6-4-13)30(28,29)22-17-18-8-2-9-19-17/h2-6,8-9,11H,7,10H2,1H3,(H,21,25)(H,18,19,22) |
| InChIKey | WFCXEONDEVDTPG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 162.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|