C17H18N4O7 — CID 19567985
dimethyl 5-[3-(5-methyl-4-nitropyrazol-1-yl)propanoylamino]benzene-1,3-dicarboxylate (PubChem CID 19567985) has the molecular formula C17H18N4O7 and a molecular weight of 390.35 g/mol. Its IUPAC name is dimethyl 5-[3-(5-methyl-4-nitropyrazol-1-yl)propanoylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-(5-methyl-4-nitropyrazol-1-yl)propanoylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 19567985 |
| Molecular Formula | C17H18N4O7 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | dimethyl 5-[3-(5-methyl-4-nitropyrazol-1-yl)propanoylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)CCn2ncc([N+](=O)[O-])c2C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C17H18N4O7/c1-10-14(21(25)26)9-18-20(10)5-4-15(22)19-13-7-11(16(23)27-2)6-12(8-13)17(24)28-3/h6-9H,4-5H2,1-3H3,(H,19,22) |
| InChIKey | RKQPNOJDOXPCBR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|