C13H12N6O7 — CID 19522574
N-(4-methyl-3,5-dinitrophenyl)-2-(5-methyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 19522574) has the molecular formula C13H12N6O7 and a molecular weight of 364.27 g/mol. Its IUPAC name is N-(4-methyl-3,5-dinitrophenyl)-2-(5-methyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-(4-methyl-3,5-dinitrophenyl)-2-(5-methyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19522574 |
| Molecular Formula | C13H12N6O7 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | N-(4-methyl-3,5-dinitrophenyl)-2-(5-methyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])cc(NC(=O)Cn2ncc([N+](=O)[O-])c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N6O7/c1-7-10(17(21)22)3-9(4-11(7)18(23)24)15-13(20)6-16-8(2)12(5-14-16)19(25)26/h3-5H,6H2,1-2H3,(H,15,20) |
| InChIKey | NGCQKKNWUREGNP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 176.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|