C23H26N4O6 — CID 19522576
N-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-2-(5-methyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 19522576) has the molecular formula C23H26N4O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is N-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-2-(5-methyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-2-(5-methyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19522576 |
| Molecular Formula | C23H26N4O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-2-(5-methyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | CCOc1ccc(COc2ccc(NC(=O)Cn3ncc([N+](=O)[O-])c3C)cc2)cc1OCC |
| InChI | InChI=1S/C23H26N4O6/c1-4-31-21-11-6-17(12-22(21)32-5-2)15-33-19-9-7-18(8-10-19)25-23(28)14-26-16(3)20(13-24-26)27(29)30/h6-13H,4-5,14-15H2,1-3H3,(H,25,28) |
| InChIKey | LHJINPUMGTWTND-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|