C22H24N4O6 — CID 19263994
N-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-methyl-4-nitropyrazole-3-carboxamide (PubChem CID 19263994) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is N-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-methyl-4-nitropyrazole-3-carboxamide.
| Compound Name | N-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-methyl-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19263994 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-methyl-4-nitropyrazole-3-carboxamide |
| SMILES | CCOc1ccc(COc2ccc(NC(=O)c3nn(C)cc3[N+](=O)[O-])cc2)cc1OCC |
| InChI | InChI=1S/C22H24N4O6/c1-4-30-19-11-6-15(12-20(19)31-5-2)14-32-17-9-7-16(8-10-17)23-22(27)21-18(26(28)29)13-25(3)24-21/h6-13H,4-5,14H2,1-3H3,(H,23,27) |
| InChIKey | ADCLXXYDODNJLE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|