C14H14F2N4O5 — CID 19522617
N-[4-(difluoromethoxy)-3-methoxyphenyl]-2-(5-methyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 19522617) has the molecular formula C14H14F2N4O5 and a molecular weight of 356.29 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-3-methoxyphenyl]-2-(5-methyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[4-(difluoromethoxy)-3-methoxyphenyl]-2-(5-methyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19522617 |
| Molecular Formula | C14H14F2N4O5 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-[4-(difluoromethoxy)-3-methoxyphenyl]-2-(5-methyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | COc1cc(NC(=O)Cn2ncc([N+](=O)[O-])c2C)ccc1OC(F)F |
| InChI | InChI=1S/C14H14F2N4O5/c1-8-10(20(22)23)6-17-19(8)7-13(21)18-9-3-4-11(25-14(15)16)12(5-9)24-2/h3-6,14H,7H2,1-2H3,(H,18,21) |
| InChIKey | IGTIEQXMHFEMFE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|