C16H15N7O5S — CID 19522441
2-(5-methyl-4-nitropyrazol-1-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 19522441) has the molecular formula C16H15N7O5S and a molecular weight of 417.41 g/mol. Its IUPAC name is 2-(5-methyl-4-nitropyrazol-1-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(5-methyl-4-nitropyrazol-1-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19522441 |
| Molecular Formula | C16H15N7O5S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-(5-methyl-4-nitropyrazol-1-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | Cc1c([N+](=O)[O-])cnn1CC(=O)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C16H15N7O5S/c1-11-14(23(25)26)9-19-22(11)10-15(24)20-12-3-5-13(6-4-12)29(27,28)21-16-17-7-2-8-18-16/h2-9H,10H2,1H3,(H,20,24)(H,17,18,21) |
| InChIKey | FSNUQFQACKRDAN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 162.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|