C18H18N8O7S — CID 19529833
N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide (PubChem CID 19529833) has the molecular formula C18H18N8O7S and a molecular weight of 490.46 g/mol. Its IUPAC name is N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide.
| Compound Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19529833 |
| Molecular Formula | C18H18N8O7S |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=O)Cn3nc([N+](=O)[O-])c([N+](=O)[O-])c3C)cc2)n1 |
| InChI | InChI=1S/C18H18N8O7S/c1-10-8-11(2)20-18(19-10)23-34(32,33)14-6-4-13(5-7-14)21-15(27)9-24-12(3)16(25(28)29)17(22-24)26(30)31/h4-8H,9H2,1-3H3,(H,21,27)(H,19,20,23) |
| InChIKey | SGBDQMBWLPNOHR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 205.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|