C18H18BrN7O7S — CID 19529606
2-(4-bromo-5-methyl-3-nitropyrazol-1-yl)-N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]acetamide (PubChem CID 19529606) has the molecular formula C18H18BrN7O7S and a molecular weight of 556.36 g/mol. Its IUPAC name is 2-(4-bromo-5-methyl-3-nitropyrazol-1-yl)-N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(4-bromo-5-methyl-3-nitropyrazol-1-yl)-N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 19529606 |
| Molecular Formula | C18H18BrN7O7S |
| Molecular Weight | 556.36 g/mol |
| Exact Mass | 555.02 |
| IUPAC Name | 2-(4-bromo-5-methyl-3-nitropyrazol-1-yl)-N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]acetamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=O)Cn3nc([N+](=O)[O-])c(Br)c3C)cc2)nc(OC)n1 |
| InChI | InChI=1S/C18H18BrN7O7S/c1-10-16(19)17(26(28)29)23-25(10)9-14(27)20-11-4-6-12(7-5-11)34(30,31)24-13-8-15(32-2)22-18(21-13)33-3/h4-8H,9H2,1-3H3,(H,20,27)(H,21,22,24) |
| InChIKey | ZQDCZXODUSAZLF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 180.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|